CAS 1354705-80-8

4-Iodo-5-(methoxymethyl)-1-methyl-1H-pyrazol-3-amine

Description:

4-Iodo-5-(methoxymethyl)-1-methyl-1H-pyrazol-3-amine is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of an iodine atom at the 4-position and a methoxymethyl group at the 5-position contributes to its unique reactivity and potential applications in medicinal chemistry. The methyl group at the 1-position enhances its lipophilicity, which may influence its biological activity and solubility. This compound may exhibit properties typical of pyrazole derivatives, such as anti-inflammatory, analgesic, or antitumor activities, making it of interest in pharmaceutical research. Its molecular structure allows for various synthetic modifications, which can lead to the development of new derivatives with enhanced efficacy or selectivity. Additionally, the presence of functional groups such as the methoxy and amino groups can facilitate interactions with biological targets, potentially leading to diverse therapeutic applications. As with many chemical substances, safety and handling precautions should be observed due to the presence of iodine and other reactive groups.

Formula: C₆H₁₀IN₃O

InChI: InChI=1S/C6H10IN3O/c1-10-4(3-11-2)5(7)6(8)9-10/h3H2,1-2H3,(H2,8,9)

InChI key: InChIKey=UTZPBNSCNUCIRI-UHFFFAOYSA-N

SMILES: C(OC)C1=C(I)C(N)=NN1C

Synonyms:

• 4-Iodo-5-(methoxymethyl)-1-methyl-1H-pyrazol-3-amine
• 1H-Pyrazol-3-amine, 4-iodo-5-(methoxymethyl)-1-methyl-