
CAS 1354705-84-2
:3-Amino-1-ethyl-4-iodo-1H-pyrazole-5-carboxylic acid
Description:
3-Amino-1-ethyl-4-iodo-1H-pyrazole-5-carboxylic acid is a heterocyclic organic compound characterized by its pyrazole ring structure, which includes an amino group, an ethyl group, and an iodine substituent. The presence of the carboxylic acid functional group contributes to its acidity and potential reactivity in various chemical reactions. This compound is typically used in pharmaceutical research and development due to its potential biological activity, particularly in the field of medicinal chemistry. The iodine atom can enhance the compound's lipophilicity and influence its interaction with biological targets. Additionally, the amino group may participate in hydrogen bonding, affecting solubility and reactivity. The compound's unique structure allows for various synthetic modifications, making it a valuable intermediate in the synthesis of more complex molecules. As with many pyrazole derivatives, it may exhibit interesting pharmacological properties, warranting further investigation into its applications in drug discovery and development.
Formula:C6H8IN3O2
InChI:InChI=1S/C6H8IN3O2/c1-2-10-4(6(11)12)3(7)5(8)9-10/h2H2,1H3,(H2,8,9)(H,11,12)
InChI key:InChIKey=GJWIYCWOIIRFOT-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1N(CC)N=C(N)C1I
Synonyms:- 3-Amino-1-ethyl-4-iodo-1H-pyrazole-5-carboxylic acid
- 1H-Pyrazole-5-carboxylic acid, 3-amino-1-ethyl-4-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.