
CAS 1354705-92-2
:5-Cyclopropyl-4-iodo-1-propyl-1H-pyrazol-3-amine
Description:
5-Cyclopropyl-4-iodo-1-propyl-1H-pyrazol-3-amine is a chemical compound characterized by its unique structural features, including a pyrazole ring, which is a five-membered ring containing two nitrogen atoms. The presence of a cyclopropyl group and an iodine atom at specific positions on the pyrazole ring contributes to its reactivity and potential biological activity. The propyl group attached to the nitrogen atom enhances its lipophilicity, which may influence its pharmacokinetic properties. This compound may exhibit interesting properties in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the iodine atom, which can participate in various chemical reactions. Additionally, the structural configuration may allow for specific interactions with biological targets, making it a candidate for further research in drug discovery. As with many organic compounds, its solubility, stability, and reactivity will depend on the surrounding conditions, including solvent and temperature. Safety and handling precautions should be observed, as with all chemical substances.
Formula:C9H14IN3
InChI:InChI=1S/C9H14IN3/c1-2-5-13-8(6-3-4-6)7(10)9(11)12-13/h6H,2-5H2,1H3,(H2,11,12)
InChI key:InChIKey=HOYPRVDIDBHIRT-UHFFFAOYSA-N
SMILES:C(CC)N1C(=C(I)C(N)=N1)C2CC2
Synonyms:- 1H-Pyrazol-3-amine, 5-cyclopropyl-4-iodo-1-propyl-
- 5-Cyclopropyl-4-iodo-1-propyl-1H-pyrazol-3-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.