
CAS 1354706-06-1
:4-Iodo-1-(2-methylpropyl)-3-nitro-1H-pyrazole
Description:
4-Iodo-1-(2-methylpropyl)-3-nitro-1H-pyrazole is a chemical compound characterized by its unique structural features, including a pyrazole ring substituted with an iodine atom, a nitro group, and a branched alkyl chain. The presence of the iodine atom contributes to its potential reactivity and applications in various chemical reactions, particularly in organic synthesis and medicinal chemistry. The nitro group is known for its electron-withdrawing properties, which can influence the compound's reactivity and stability. The 2-methylpropyl substituent adds steric bulk, potentially affecting the compound's interactions with biological targets or its solubility in different solvents. This compound may exhibit interesting biological activities, making it a candidate for further research in pharmacology or agrochemicals. Its specific properties, such as melting point, boiling point, and solubility, would need to be determined through experimental methods, as they are crucial for understanding its behavior in various applications. Overall, 4-Iodo-1-(2-methylpropyl)-3-nitro-1H-pyrazole represents a versatile structure in the realm of organic chemistry.
Formula:C7H10IN3O2
InChI:InChI=1S/C7H10IN3O2/c1-5(2)3-10-4-6(8)7(9-10)11(12)13/h4-5H,3H2,1-2H3
InChI key:InChIKey=DVNLPKVFIJBHJG-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=NN(CC(C)C)C=C1I
Synonyms:- 4-Iodo-1-(2-methylpropyl)-3-nitro-1H-pyrazole
- 1H-Pyrazole, 4-iodo-1-(2-methylpropyl)-3-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.