CAS 1354706-07-2

3-Bromo-5-methyl-1-propyl-1H-pyrazole

Description:

3-Bromo-5-methyl-1-propyl-1H-pyrazole is an organic compound characterized by its pyrazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of a bromine atom at the 3-position and a methyl group at the 5-position, along with a propyl substituent at the 1-position, contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the electronegative bromine atom and the presence of the nitrogen atoms in the pyrazole ring. It may participate in various chemical reactions typical of halogenated compounds, such as nucleophilic substitutions or coupling reactions. The structure suggests potential applications in pharmaceuticals or agrochemicals, as pyrazole derivatives are often explored for their biological activities. Additionally, the compound's stability and reactivity can be influenced by the steric and electronic effects of the substituents on the pyrazole ring. Overall, 3-Bromo-5-methyl-1-propyl-1H-pyrazole represents a versatile scaffold in organic synthesis and medicinal chemistry.

Formula: C₇H₁₁BrN₂

InChI: InChI=1S/C7H11BrN2/c1-3-4-10-6(2)5-7(8)9-10/h5H,3-4H2,1-2H3

InChI key: InChIKey=PDBUAVDHSKSNLN-UHFFFAOYSA-N

SMILES: C(CC)N1C(C)=CC(Br)=N1

Synonyms:

• 1H-Pyrazole, 3-bromo-5-methyl-1-propyl-
• 3-Bromo-5-methyl-1-propyl-1H-pyrazole