CAS 1354706-16-3

1-(2-Methylpropyl)-1H-pyrazole-3-sulfonyl chloride

Description:

1-(2-Methylpropyl)-1H-pyrazole-3-sulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and ability to form sulfonamides. This compound features a pyrazole ring, a five-membered heterocyclic structure containing two nitrogen atoms, which contributes to its unique chemical properties. The presence of the 2-methylpropyl group enhances its hydrophobic characteristics, potentially influencing its solubility and interaction with other molecules. As a sulfonyl chloride, it is likely to be a potent electrophile, making it useful in various synthetic applications, particularly in the formation of sulfonamides and other derivatives. The compound may also exhibit biological activity, although specific biological properties would require further investigation. Safety precautions should be taken when handling this substance, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or amines. Overall, 1-(2-Methylpropyl)-1H-pyrazole-3-sulfonyl chloride is a versatile compound with potential applications in organic synthesis and medicinal chemistry.

Formula: C₇H₁₁ClN₂O₂S

InChI: InChI=1S/C7H11ClN2O2S/c1-6(2)5-10-4-3-7(9-10)13(8,11)12/h3-4,6H,5H2,1-2H3

InChI key: InChIKey=RDNAMJDVKDXLGD-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C1=NN(CC(C)C)C=C1

Synonyms:

• 1H-Pyrazole-3-sulfonyl chloride, 1-(2-methylpropyl)-
• 1-(2-Methylpropyl)-1H-pyrazole-3-sulfonyl chloride