CAS 1354706-21-0

1-(Difluoromethyl)-1H-pyrazole-3-acetic acid

Description:

1-(Difluoromethyl)-1H-pyrazole-3-acetic acid is a chemical compound characterized by its unique pyrazole structure, which includes a difluoromethyl group and an acetic acid moiety. This compound typically exhibits properties associated with both pyrazole derivatives and carboxylic acids, such as moderate solubility in polar solvents and potential reactivity due to the presence of the carboxylic acid functional group. The difluoromethyl group can influence the compound's electronic properties and lipophilicity, potentially enhancing its biological activity. Pyrazole derivatives are often studied for their pharmacological properties, including anti-inflammatory and analgesic effects. The presence of fluorine atoms can also affect the compound's stability and interaction with biological targets. Overall, 1-(Difluoromethyl)-1H-pyrazole-3-acetic acid is of interest in medicinal chemistry and may have applications in drug development, although specific biological activities and applications would require further investigation.

Formula: C₆H₆F₂N₂O₂

InChI: InChI=1S/C6H6F2N2O2/c7-6(8)10-2-1-4(9-10)3-5(11)12/h1-2,6H,3H2,(H,11,12)

InChI key: InChIKey=JXKUYTZHQZEUKY-UHFFFAOYSA-N

SMILES: C(C(O)=O)C1=NN(C(F)F)C=C1

Synonyms:

• 1H-Pyrazole-3-acetic acid, 1-(difluoromethyl)-
• 1-(Difluoromethyl)-1H-pyrazole-3-acetic acid

2-[1-(Difluoromethyl)-1H-pyrazol-3-yl]acetic acid

CAS: 1354706-21-0

Versatile small molecule scaffold

Formula: C₆H₆F₂N₂O₂

Purity: Min. 95%

Molecular weight: 176.12 g/mol

Ref: 3D-EEC70621