CAS 1354706-22-1

4-(1-Ethyl-5-methyl-1H-pyrazol-4-yl)-1-methyl-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid

Description:

4-(1-Ethyl-5-methyl-1H-pyrazol-4-yl)-1-methyl-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid is a complex organic compound characterized by its unique pyrazolo and pyridine ring structures. This compound features multiple functional groups, including a carboxylic acid, which contributes to its acidic properties. The presence of ethyl and methyl substituents on the pyrazole ring enhances its lipophilicity and may influence its biological activity. The compound's molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, the compound's CAS number, 1354706-22-1, allows for precise identification in chemical databases and literature. Overall, this substance may exhibit unique pharmacological properties, warranting further investigation for potential applications in drug development or other fields of chemistry.

Formula: C₁₄H₁₅N₅O₂

InChI: InChI=1S/C14H15N5O2/c1-4-19-8(2)10(7-16-19)9-5-6-15-13-11(9)12(14(20)21)17-18(13)3/h5-7H,4H2,1-3H3,(H,20,21)

InChI key: InChIKey=FNHYLOCFLIDFTP-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(C=CN=C2N(C)N1)C3=C(C)N(CC)N=C3

Synonyms:

• 1H-Pyrazolo[3,4-b]pyridine-3-carboxylic acid, 4-(1-ethyl-5-methyl-1H-pyrazol-4-yl)-1-methyl-
• 4-(1-Ethyl-5-methyl-1H-pyrazol-4-yl)-1-methyl-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid