CAS 1354706-23-2

1-Methyl-4-(3-nitrophenyl)-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid

Description:

1-Methyl-4-(3-nitrophenyl)-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid is a heterocyclic organic compound characterized by its complex structure, which includes a pyrazolo-pyridine core. This compound features a methyl group and a nitrophenyl substituent, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions and may form salts with bases. Additionally, the nitro group can influence the compound's reactivity and polarity, potentially affecting its biological activity. This compound may be of interest in medicinal chemistry and drug development due to its structural features, which could interact with biological targets. As with many organic compounds, safety precautions should be observed when handling it, as it may pose health risks or environmental hazards.

Formula: C₁₄H₁₀N₄O₄

InChI: InChI=1S/C14H10N4O4/c1-17-13-11(12(16-17)14(19)20)10(5-6-15-13)8-3-2-4-9(7-8)18(21)22/h2-7H,1H3,(H,19,20)

InChI key: InChIKey=WEXSUPMOCTXKDZ-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(C=CN=C2N(C)N1)C3=CC(N(=O)=O)=CC=C3

Synonyms:

• 1-Methyl-4-(3-nitrophenyl)-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid
• 1H-Pyrazolo[3,4-b]pyridine-3-carboxylic acid, 1-methyl-4-(3-nitrophenyl)-