CAS 1354706-24-3

1-Methyl-4-phenyl-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid

Description:

1-Methyl-4-phenyl-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid is a heterocyclic compound characterized by its pyrazolo-pyridine structure, which incorporates both a pyrazole and a pyridine ring. This compound features a methyl group at the 1-position and a phenyl group at the 4-position of the pyrazole ring, contributing to its unique chemical properties. The presence of a carboxylic acid functional group at the 3-position enhances its acidity and potential for forming hydrogen bonds, making it a candidate for various chemical reactions and applications. Its molecular structure suggests potential biological activity, which may include interactions with specific receptors or enzymes. The compound's solubility, stability, and reactivity can be influenced by the substituents on the rings, and it may exhibit interesting pharmacological properties. As with many heterocycles, its synthesis and characterization are of interest in medicinal chemistry and drug development, particularly in the search for novel therapeutic agents.

Formula: C₁₄H₁₁N₃O₂

InChI: InChI=1S/C14H11N3O2/c1-17-13-11(12(16-17)14(18)19)10(7-8-15-13)9-5-3-2-4-6-9/h2-8H,1H3,(H,18,19)

InChI key: InChIKey=KPSHQRCAIZJHRL-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(C=CN=C2N(C)N1)C3=CC=CC=C3

Synonyms:

• 1H-Pyrazolo[3,4-b]pyridine-3-carboxylic acid, 1-methyl-4-phenyl-
• 1-Methyl-4-phenyl-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid

1-Methyl-4-phenyl-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid

CAS: 1354706-24-3

Versatile small molecule scaffold

Formula: C₁₄H₁₁N₃O₂

Purity: Min. 95%

Molecular weight: 253.26 g/mol

Ref: 3D-EEC70624