CAS 1354706-25-4

4-(3-Aminophenyl)-1-methyl-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid

Description:

4-(3-Aminophenyl)-1-methyl-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid is a chemical compound characterized by its complex structure, which includes a pyrazolo-pyridine core and an amino group attached to a phenyl ring. This compound typically exhibits properties such as moderate solubility in polar solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the carboxylic acid functional group suggests it may participate in hydrogen bonding and ionic interactions, which can influence its reactivity and biological activity. The compound may also exhibit specific pharmacological properties, potentially acting as an inhibitor or modulator in various biological pathways. Its molecular structure allows for interactions with biological targets, which can be explored for therapeutic applications. As with many organic compounds, stability, reactivity, and solubility can vary based on environmental conditions such as pH and temperature. Further studies would be necessary to fully elucidate its properties and potential applications in drug development or other fields.

Formula: C₁₄H₁₂N₄O₂

InChI: InChI=1S/C14H12N4O2/c1-18-13-11(12(17-18)14(19)20)10(5-6-16-13)8-3-2-4-9(15)7-8/h2-7H,15H2,1H3,(H,19,20)

InChI key: InChIKey=YLQHTJWHBAWPOO-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(C=CN=C2N(C)N1)C3=CC(N)=CC=C3

Synonyms:

• 4-(3-Aminophenyl)-1-methyl-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid
• 1H-Pyrazolo[3,4-b]pyridine-3-carboxylic acid, 4-(3-aminophenyl)-1-methyl-

4-(3-Aminophenyl)-1-methyl-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid

CAS: 1354706-25-4

Versatile small molecule scaffold

Formula: C₁₄H₁₂N₄O₂

Purity: Min. 95%

Molecular weight: 268.27 g/mol

Ref: 3D-EEC70625