CAS 1354706-33-4

4-[4-(1H-Imidazol-1-yl)phenyl]-1-methyl-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid

Description:

4-[4-(1H-Imidazol-1-yl)phenyl]-1-methyl-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid, with the CAS number 1354706-33-4, is a chemical compound characterized by its complex heterocyclic structure, which includes both imidazole and pyrazolo-pyridine moieties. This compound typically exhibits properties such as moderate solubility in polar solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the carboxylic acid functional group suggests it may participate in hydrogen bonding and could act as a weak acid. Its structural features may contribute to interactions with biological targets, potentially influencing its pharmacological profile. Additionally, the compound's molecular weight and specific stereochemistry can affect its reactivity and stability. Overall, this substance is likely to be investigated for its potential applications in drug development, particularly in areas related to cancer or infectious diseases, due to the presence of the imidazole ring, which is often associated with biological activity.

Formula: C₁₇H₁₃N₅O₂

InChI: InChI=1S/C17H13N5O2/c1-21-16-14(15(20-21)17(23)24)13(6-7-19-16)11-2-4-12(5-3-11)22-9-8-18-10-22/h2-10H,1H3,(H,23,24)

InChI key: InChIKey=FKGJIMPUXDHPRJ-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(C=CN=C2N(C)N1)C3=CC=C(C=C3)N4C=CN=C4

Synonyms:

• 4-[4-(1H-Imidazol-1-yl)phenyl]-1-methyl-1H-pyrazolo[3,4-b]pyridine-3-carboxylic acid
• 1H-Pyrazolo[3,4-b]pyridine-3-carboxylic acid, 4-[4-(1H-imidazol-1-yl)phenyl]-1-methyl-