CymitQuimica logo

CAS 1354706-50-5

:

3-(3-Cyclopropyl-1-methyl-1H-pyrazol-4-yl)-2-propynoic acid

Description:
3-(3-Cyclopropyl-1-methyl-1H-pyrazol-4-yl)-2-propynoic acid is a chemical compound characterized by its unique structural features, which include a cyclopropyl group and a pyrazole ring. The presence of the propynoic acid moiety indicates that it has an alkyne functional group, contributing to its reactivity and potential applications in organic synthesis. This compound is likely to exhibit properties typical of both pyrazole derivatives and alkyne-containing acids, such as potential acidity due to the carboxylic acid group and the ability to participate in various chemical reactions, including nucleophilic additions and cycloadditions. The cyclopropyl group may impart strain and influence the compound's overall stability and reactivity. Additionally, the presence of the methyl group on the pyrazole ring can affect its electronic properties and steric hindrance. Overall, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural characteristics and potential biological activity.
Formula:C10H10N2O2
InChI:InChI=1S/C10H10N2O2/c1-12-6-8(4-5-9(13)14)10(11-12)7-2-3-7/h6-7H,2-3H2,1H3,(H,13,14)
InChI key:InChIKey=BZOYZSRSQFLQFS-UHFFFAOYSA-N
SMILES:C(#CC(O)=O)C=1C(=NN(C)C1)C2CC2
Synonyms:
  • 3-(3-Cyclopropyl-1-methyl-1H-pyrazol-4-yl)-2-propynoic acid
  • 2-Propynoic acid, 3-(3-cyclopropyl-1-methyl-1H-pyrazol-4-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.