CymitQuimica logo

CAS 1354706-78-7

:

5-Cyclopropyl-4-iodo-1-methyl-1H-pyrazol-3-amine

Description:
5-Cyclopropyl-4-iodo-1-methyl-1H-pyrazol-3-amine is a chemical compound characterized by its unique pyrazole structure, which includes a cyclopropyl group and an iodine substituent. This compound features a five-membered heterocyclic ring containing two nitrogen atoms, contributing to its reactivity and potential biological activity. The presence of the iodine atom enhances its electrophilic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions. The cyclopropyl group introduces strain and can influence the compound's conformational flexibility and steric interactions. Additionally, the methyl group attached to the pyrazole ring can affect the compound's solubility and lipophilicity. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its specific applications and biological activities would depend on further studies and investigations. As with many halogenated compounds, safety and handling precautions are essential due to potential toxicity and environmental impact.
Formula:C7H10IN3
InChI:InChI=1S/C7H10IN3/c1-11-6(4-2-3-4)5(8)7(9)10-11/h4H,2-3H2,1H3,(H2,9,10)
InChI key:InChIKey=WEXDKZNMZZKYMT-UHFFFAOYSA-N
SMILES:IC1=C(N(C)N=C1N)C2CC2
Synonyms:
  • 1H-Pyrazol-3-amine, 5-cyclopropyl-4-iodo-1-methyl-
  • 5-Cyclopropyl-4-iodo-1-methyl-1H-pyrazol-3-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.