
CAS 1354706-79-8
:1-(2,2-Difluoroethyl)-4-iodo-5-methyl-1H-pyrazol-3-amine
Description:
1-(2,2-Difluoroethyl)-4-iodo-5-methyl-1H-pyrazol-3-amine is a chemical compound characterized by its unique molecular structure, which includes a pyrazole ring substituted with various functional groups. The presence of a difluoroethyl group introduces significant electronegativity, influencing the compound's reactivity and potential interactions. The iodine atom contributes to the compound's halogen characteristics, which can enhance its biological activity and lipophilicity. Additionally, the methyl group at the 5-position of the pyrazole ring can affect steric hindrance and electronic properties. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its specific characteristics, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other functional groups. Overall, this compound's unique combination of fluorine, iodine, and pyrazole moieties suggests potential applications in drug development and material science, warranting further investigation into its properties and uses.
Formula:C6H8F2IN3
InChI:InChI=1S/C6H8F2IN3/c1-3-5(9)6(10)11-12(3)2-4(7)8/h4H,2H2,1H3,(H2,10,11)
InChI key:InChIKey=PFOLMGAFEBUYDE-UHFFFAOYSA-N
SMILES:C(C(F)F)N1C(C)=C(I)C(N)=N1
Synonyms:- 1H-Pyrazol-3-amine, 1-(2,2-difluoroethyl)-4-iodo-5-methyl-
- 1-(2,2-Difluoroethyl)-4-iodo-5-methyl-1H-pyrazol-3-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.