
CAS 1354706-80-1
:4-Iodo-1-(2-methylpropyl)-1H-pyrazol-3-amine
Description:
4-Iodo-1-(2-methylpropyl)-1H-pyrazol-3-amine is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. The presence of an iodine atom at the 4-position and a 2-methylpropyl group at the 1-position contributes to its unique properties. This compound is likely to exhibit moderate to high lipophilicity due to the alkyl substituent, which can influence its solubility in organic solvents. The amino group at the 3-position can participate in hydrogen bonding, making it potentially reactive in various chemical reactions, including nucleophilic substitutions. Additionally, the iodine atom may impart specific reactivity, such as facilitating electrophilic aromatic substitution or serving as a leaving group in certain reactions. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyrazole moiety, which is often associated with biological activity. However, specific biological properties and safety profiles would require further investigation through empirical studies.
Formula:C7H12IN3
InChI:InChI=1S/C7H12IN3/c1-5(2)3-11-4-6(8)7(9)10-11/h4-5H,3H2,1-2H3,(H2,9,10)
InChI key:InChIKey=GFZNPWXSWFBQIQ-UHFFFAOYSA-N
SMILES:C(C(C)C)N1C=C(I)C(N)=N1
Synonyms:- 1H-Pyrazol-3-amine, 4-iodo-1-(2-methylpropyl)-
- 4-Iodo-1-(2-methylpropyl)-1H-pyrazol-3-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.