CAS 1354706-88-9
:3-Bromo-1H-pyrazole-1-propanamine
Description:
3-Bromo-1H-pyrazole-1-propanamine is an organic compound characterized by its pyrazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of a bromine atom at the 3-position of the pyrazole ring contributes to its reactivity and potential applications in various chemical reactions. The propanamine group indicates the presence of a three-carbon chain with an amine functional group, which enhances its solubility in polar solvents and may influence its biological activity. This compound may exhibit properties such as being a potential intermediate in the synthesis of pharmaceuticals or agrochemicals, owing to the functional groups present. Additionally, the bromine substituent can serve as a site for further chemical modifications, making it a versatile building block in organic synthesis. Safety and handling precautions should be observed, as with many brominated compounds, due to potential toxicity and environmental concerns. Overall, 3-Bromo-1H-pyrazole-1-propanamine is of interest in both synthetic chemistry and medicinal chemistry contexts.
Formula:C6H10BrN3
InChI:InChI=1S/C6H10BrN3/c7-6-2-5-10(9-6)4-1-3-8/h2,5H,1,3-4,8H2
InChI key:InChIKey=MRVVMRIWCNWFAA-UHFFFAOYSA-N
SMILES:C(CCN)N1N=C(Br)C=C1
Synonyms:- 1H-Pyrazole-1-propanamine, 3-bromo-
- 3-Bromo-1H-pyrazole-1-propanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.