CAS 1354752-82-1

1-(9H-Fluoren-9-ylmethyl) (3S)-3-(phenylmethyl)-1,3-piperidinedicarboxylate

Description:

1-(9H-Fluoren-9-ylmethyl) (3S)-3-(phenylmethyl)-1,3-piperidinedicarboxylate is a chemical compound characterized by its complex structure, which includes a piperidine ring substituted with two carboxylate groups and a fluorenylmethyl group. This compound is typically used in organic synthesis and medicinal chemistry due to its potential biological activity. The presence of the fluorenyl group contributes to its aromatic properties, while the piperidine moiety may influence its pharmacological profile. The stereochemistry indicated by the (3S) designation suggests that the compound has specific spatial arrangements that can affect its interactions with biological targets. Additionally, the presence of the phenylmethyl group enhances its lipophilicity, which may impact its solubility and permeability in biological systems. Overall, this compound's unique structural features make it a subject of interest for research in drug development and chemical synthesis.

Formula: C₂₈H₂₇NO₄

InChI: InChI=1S/C28H27NO4/c30-26(31)28(17-20-9-2-1-3-10-20)15-8-16-29(19-28)27(32)33-18-25-23-13-6-4-11-21(23)22-12-5-7-14-24(22)25/h1-7,9-14,25H,8,15-19H2,(H,30,31)/t28-/m0/s1

InChI key: InChIKey=MPPGEVRAOIMFQJ-NDEPHWFRSA-N

SMILES: C(OC(=O)N1C[C@](CC2=CC=CC=C2)(C(O)=O)CCC1)C3C=4C(C=5C3=CC=CC5)=CC=CC4

Synonyms:

• 1-(9H-Fluoren-9-ylmethyl) (3S)-3-(phenylmethyl)-1,3-piperidinedicarboxylate
• 1,3-Piperidinedicarboxylic acid, 3-(phenylmethyl)-, 1-(9H-fluoren-9-ylmethyl) ester, (3S)-