CAS 1354783-32-6

1-Cyclopropyl-1H-pyrrole-3-carboxaldehyde

Description:

1-Cyclopropyl-1H-pyrrole-3-carboxaldehyde is an organic compound characterized by its unique structure, which includes a pyrrole ring fused with a cyclopropyl group and an aldehyde functional group. The presence of the cyclopropyl moiety contributes to its distinctive chemical reactivity and steric properties, while the aldehyde group allows for further functionalization and reactivity in synthetic applications. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, which makes it useful in various chemical reactions, including those involving nucleophilic additions or condensation reactions. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its synthesis often involves multi-step organic reactions, and it can serve as an intermediate in the preparation of more complex molecules. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards.

Formula: C₈H₉NO

InChI: InChI=1S/C8H9NO/c10-6-7-3-4-9(5-7)8-1-2-8/h3-6,8H,1-2H2

InChI key: InChIKey=ZXSGRUMQBGSWQF-UHFFFAOYSA-N

SMILES: C(=O)C1=CN(C=C1)C2CC2

Synonyms:

• 1H-Pyrrole-3-carboxaldehyde, 1-cyclopropyl-
• 1-Cyclopropyl-1H-pyrrole-3-carboxaldehyde