CymitQuimica logo

CAS 1354792-76-9

:

Azetidine, 3-(difluoromethyl)-, hydrochloride (1:1)

Description:
Azetidine, 3-(difluoromethyl)-, hydrochloride (1:1) is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocyclic compound containing one nitrogen atom. The presence of a difluoromethyl group at the 3-position of the azetidine ring introduces unique reactivity and properties, particularly in terms of its electronic characteristics and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its utility in pharmaceutical applications. The compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, and the difluoromethyl group can influence lipophilicity and metabolic stability. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity. Further studies would be necessary to fully elucidate its properties and applications in various fields, including drug development and synthetic chemistry.
Formula:C4H7F2N·ClH
InChI:InChI=1S/C4H7F2N.ClH/c5-4(6)3-1-7-2-3;/h3-4,7H,1-2H2;1H
InChI key:InChIKey=NYMQWAUMUHQGQQ-UHFFFAOYSA-N
SMILES:C(F)(F)C1CNC1.Cl
Synonyms:
  • 3-(Difluoromethyl)azetidine hydrochloride
  • Azetidine, 3-(difluoromethyl)-, hydrochloride (1:1)
Found 5 products.