
CAS 1354819-39-8
:1-[2-Methoxy-5-(trifluoromethyl)phenyl]-2-propanone
Description:
1-[2-Methoxy-5-(trifluoromethyl)phenyl]-2-propanone, identified by its CAS number 1354819-39-8, is an organic compound characterized by its unique molecular structure, which includes a methoxy group and a trifluoromethyl group attached to a phenyl ring. This compound typically exhibits properties associated with aromatic ketones, such as moderate volatility and solubility in organic solvents. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its reactivity and interaction with biological systems. The methoxy group can also participate in various chemical reactions, making this compound potentially useful in synthetic organic chemistry. Additionally, the compound's structure suggests it may have applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation. Overall, its distinctive functional groups contribute to its chemical behavior and potential utility in various chemical applications.
Formula:C11H11F3O2
InChI:InChI=1S/C11H11F3O2/c1-7(15)5-8-6-9(11(12,13)14)3-4-10(8)16-2/h3-4,6H,5H2,1-2H3
InChI key:InChIKey=FZPGAUWOPLHLOS-UHFFFAOYSA-N
SMILES:C(C(C)=O)C1=C(OC)C=CC(C(F)(F)F)=C1
Synonyms:- 1-[2-Methoxy-5-(trifluoromethyl)phenyl]-2-propanone
- 2-Propanone, 1-[2-methoxy-5-(trifluoromethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.