CymitQuimica logo

CAS 1354940-64-9

:

Ethyl 4-(methylsulfonyl)-2-(4-morpholinyl)benzoate

Description:
Ethyl 4-(methylsulfonyl)-2-(4-morpholinyl)benzoate is a chemical compound characterized by its complex structure, which includes an ethyl ester group, a methylsulfonyl moiety, and a morpholine ring. This compound typically exhibits properties such as being a solid or liquid at room temperature, depending on its specific formulation and purity. It is likely to be soluble in organic solvents due to the presence of the ethyl and morpholine groups, while its solubility in water may be limited. The presence of the methylsulfonyl group suggests potential polar characteristics, which can influence its reactivity and interaction with biological systems. Ethyl 4-(methylsulfonyl)-2-(4-morpholinyl)benzoate may have applications in pharmaceuticals or agrochemicals, given the functional groups that can participate in various chemical reactions. Safety data sheets would provide essential information regarding its handling, toxicity, and environmental impact, which are crucial for any practical applications.
Formula:C14H19NO5S
InChI:InChI=1S/C14H19NO5S/c1-3-20-14(16)12-5-4-11(21(2,17)18)10-13(12)15-6-8-19-9-7-15/h4-5,10H,3,6-9H2,1-2H3
InChI key:InChIKey=NBCRKUAGLWPIGQ-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(C=C(S(C)(=O)=O)C=C1)N2CCOCC2
Synonyms:
  • Benzoic acid, 4-(methylsulfonyl)-2-(4-morpholinyl)-, ethyl ester
  • Ethyl 4-(methylsulfonyl)-2-(4-morpholinyl)benzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.