
CAS 1354940-70-7
:2-Pyridinamine, 5-(4-morpholinyl)-, hydrochloride (1:1)
Description:
2-Pyridinamine, 5-(4-morpholinyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyridine and morpholine functional groups. It typically appears as a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. This compound is often studied for its potential biological activities, particularly in medicinal chemistry, where it may exhibit properties relevant to pharmacology. The presence of the morpholine ring can contribute to its ability to interact with biological targets, making it of interest in drug development. Its molecular structure includes an amine group, which can participate in hydrogen bonding, influencing its reactivity and interaction with other molecules. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are taken. Overall, 2-Pyridinamine, 5-(4-morpholinyl)-, hydrochloride is a compound of interest in various chemical and biological research fields.
Formula:C9H13N3O·ClH
InChI:InChI=1S/C9H13N3O.ClH/c10-9-2-1-8(7-11-9)12-3-5-13-6-4-12;/h1-2,7H,3-6H2,(H2,10,11);1H
InChI key:InChIKey=XMDVLVNMYLVNGZ-UHFFFAOYSA-N
SMILES:NC=1C=CC(=CN1)N2CCOCC2.Cl
Synonyms:- 2-Pyridinamine, 5-(4-morpholinyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
