CAS 1354940-85-4
:Methyl 1-(3-pyridinyl)cyclopropanecarboxylate
Description:
Methyl 1-(3-pyridinyl)cyclopropanecarboxylate is an organic compound characterized by its unique structure, which includes a cyclopropane ring and a pyridine moiety. This compound features a carboxylate functional group, specifically an ester, indicated by the presence of the methyl ester group. The pyridine ring contributes to the compound's potential biological activity, as heterocyclic aromatic compounds often exhibit diverse pharmacological properties. The cyclopropane structure adds to the compound's rigidity and may influence its reactivity and interaction with biological targets. Methyl 1-(3-pyridinyl)cyclopropanecarboxylate is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its solubility in organic solvents and limited solubility in water are common characteristics of such esters. The compound's synthesis often involves the reaction of cyclopropanecarboxylic acid derivatives with pyridine-based reagents, making it of interest in medicinal chemistry and organic synthesis. As with many organic compounds, safety data should be consulted for handling and usage.
Formula:C10H11NO2
InChI:InChI=1S/C10H11NO2/c1-13-9(12)10(4-5-10)8-3-2-6-11-7-8/h2-3,6-7H,4-5H2,1H3
InChI key:InChIKey=IXGCYJWJMZNBCJ-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1(CC1)C=2C=CC=NC2
Synonyms:- Cyclopropanecarboxylic acid, 1-(3-pyridinyl)-, methyl ester
- Methyl 1-(3-pyridinyl)cyclopropanecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
