CAS 1354949-36-2

2-Thiopheneacetic acid, 4-bromo-α-[[(tetrahydro-2-furanyl)methyl]amino]-, hydrochloride (1:1)

Description:

2-Thiopheneacetic acid, 4-bromo-α-[[[tetrahydro-2-furanyl)methyl]amino]-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a thiophene ring, a bromo substituent, and a tetrahydrofuran moiety. This compound is typically classified as an amino acid derivative due to the presence of the carboxylic acid functional group and an amine. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, including pharmaceutical research. The presence of the bromine atom suggests potential reactivity and may influence its biological activity. The tetrahydrofuran group contributes to the compound's overall polarity and may affect its interaction with biological targets. As with many compounds containing heterocycles, it may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. However, specific biological activities and applications would require further investigation and empirical data.

Formula: C₁₁H₁₄BrNO₃S·ClH

InChI: InChI=1S/C11H14BrNO3S.ClH/c12-7-4-9(17-6-7)10(11(14)15)13-5-8-2-1-3-16-8;/h4,6,8,10,13H,1-3,5H2,(H,14,15);1H

InChI key: InChIKey=YMWQTDWBOGCSSR-UHFFFAOYSA-N

SMILES: C(NCC1CCCO1)(C(O)=O)C2=CC(Br)=CS2.Cl

Synonyms:

• 2-Thiopheneacetic acid, 4-bromo-α-[[(tetrahydro-2-furanyl)methyl]amino]-, hydrochloride (1:1)

2-(4-Bromothiophen-2-yl)-2-[(oxolan-2-ylmethyl)amino]acetic acid hydrochloride

CAS: 1354949-36-2

Versatile small molecule scaffold

Formula: C₁₁H₁₅BrClNO₃S

Purity: Min. 95%

Molecular weight: 356.66 g/mol

Ref: 3D-EEC94936