CAS 1354949-38-4

2-Ethyl-4H-1-benzopyran-3-carboxylic acid

Description:

2-Ethyl-4H-1-benzopyran-3-carboxylic acid, identified by its CAS number 1354949-38-4, is a chemical compound that belongs to the class of benzopyran derivatives. This compound features a benzopyran core, which is a fused ring structure consisting of a benzene ring and a pyran ring, along with an ethyl substituent and a carboxylic acid functional group. The presence of the carboxylic acid group imparts acidic properties, making it capable of participating in various chemical reactions, such as esterification and neutralization. The ethyl group contributes to the compound's hydrophobic characteristics, influencing its solubility in organic solvents. Additionally, benzopyran derivatives are known for their potential biological activities, including antioxidant and anti-inflammatory properties. The structural features of 2-Ethyl-4H-1-benzopyran-3-carboxylic acid may also suggest potential applications in pharmaceuticals or agrochemicals, although specific applications would depend on further research and characterization. Overall, this compound exemplifies the diverse chemistry associated with benzopyran derivatives.

Formula: C₁₂H₁₂O₃

InChI: InChI=1S/C12H12O3/c1-2-10-9(12(13)14)7-8-5-3-4-6-11(8)15-10/h3-6H,2,7H2,1H3,(H,13,14)

InChI key: InChIKey=HTXKPILAAQJECD-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(CC)OC=2C(C1)=CC=CC2

Synonyms:

• 4H-1-Benzopyran-3-carboxylic acid, 2-ethyl-
• 2-Ethyl-4H-1-benzopyran-3-carboxylic acid

2-Ethyl-4H-chromene-3-carboxylic acid

CAS: 1354949-38-4

Versatile small molecule scaffold

Formula: C₁₂H₁₂O₃

Purity: Min. 95%

Molecular weight: 204.22 g/mol

Ref: 3D-EEC94938