CAS 1354949-47-5

1-Piperazineacetic acid, α,α,4-trimethyl-, hydrobromide (1:2)

Description:

1-Piperazineacetic acid, α,α,4-trimethyl-, hydrobromide (1:2) is a chemical compound characterized by its piperazine and acetic acid moieties, which contribute to its biological activity and potential pharmacological applications. The presence of the trimethyl group enhances its lipophilicity, potentially influencing its interaction with biological membranes. As a hydrobromide salt, it is likely to exhibit increased solubility in aqueous environments, which is advantageous for formulation in pharmaceutical contexts. This compound may possess properties such as being a zwitterion, allowing it to participate in various ionic interactions. Its structure suggests potential applications in medicinal chemistry, particularly in the development of agents targeting neurological or psychiatric disorders, given the role of piperazine derivatives in such therapeutic areas. Additionally, the hydrobromide form may enhance stability and bioavailability. However, specific biological activities, toxicity profiles, and detailed physicochemical properties would require further investigation through experimental studies and literature review.

Formula: C₉H₁₈N₂O₂·2BrH

InChI: InChI=1S/C9H18N2O2.2BrH/c1-9(2,8(12)13)11-6-4-10(3)5-7-11;;/h4-7H2,1-3H3,(H,12,13);2*1H

InChI key: InChIKey=AXVCPVRRPRWFJD-UHFFFAOYSA-N

SMILES: C(C(O)=O)(C)(C)N1CCN(C)CC1.Br

Synonyms:

• 1-Piperazineacetic acid, α,α,4-trimethyl-, hydrobromide (1:2)
• 2-Methyl-2-(4-methylpiperazin-1-yl)propanoic acid dihydrobromide

2-Methyl-2-(4-methylpiperazin-1-yl)propanoic acid dihydrobromide

CAS: 1354949-47-5

Versatile small molecule scaffold

Formula: C₉H₂₀Br₂N₂O₂

Purity: Min. 95%

Molecular weight: 348.08 g/mol

Ref: 3D-EEC94947