CAS 1354949-51-1

5-(Chloromethyl)-3-[1-(2-methylpropoxy)ethyl]-1,2,4-oxadiazole

Description:

5-(Chloromethyl)-3-[1-(2-methylpropoxy)ethyl]-1,2,4-oxadiazole is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. The presence of a chloromethyl group indicates that it has a chlorine atom attached to a carbon chain, which can enhance its reactivity and potential applications in organic synthesis. The compound also features a branched alkyl group, specifically a 2-methylpropoxy group, which contributes to its hydrophobic characteristics and may influence its solubility in various solvents. This structure suggests potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. The unique combination of functional groups may impart specific biological activities or chemical reactivity, making it of interest in medicinal chemistry or material science. As with many chemical substances, safety and handling precautions should be observed due to the presence of chlorine and the potential for reactivity associated with the oxadiazole moiety.

Formula: C₉H₁₅ClN₂O₂

InChI: InChI=1S/C9H15ClN2O2/c1-6(2)5-13-7(3)9-11-8(4-10)14-12-9/h6-7H,4-5H2,1-3H3

InChI key: InChIKey=YYMSMGUSGDGKRX-UHFFFAOYSA-N

SMILES: C(OCC(C)C)(C)C=1N=C(CCl)ON1

Synonyms:

• 5-(Chloromethyl)-3-[1-(2-methylpropoxy)ethyl]-1,2,4-oxadiazole
• 1,2,4-Oxadiazole, 5-(chloromethyl)-3-[1-(2-methylpropoxy)ethyl]-

5-(Chloromethyl)-3-[1-(2-methylpropoxy)ethyl]-1,2,4-oxadiazole

CAS: 1354949-51-1

Versatile small molecule scaffold

Formula: C₉H₁₅ClN₂O₂

Purity: Min. 95%

Molecular weight: 218.68 g/mol

Ref: 3D-EEC94951