CAS 1354949-55-5

Cyclopropanemethanamine, N-cyclopropyl-1-(3,5-dimethylphenyl)-, hydrochloride (1:1)

Description:

Cyclopropanemethanamine, N-cyclopropyl-1-(3,5-dimethylphenyl)-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a cyclopropyl group and a substituted phenyl ring. The presence of the hydrochloride indicates that it is a salt form, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. This compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its reactivity and interactions with biological systems. The specific arrangement of the 3,5-dimethyl groups on the phenyl ring can affect its steric and electronic properties, potentially impacting its biological activity. As with many amines, it may also participate in various chemical reactions, including alkylation and acylation. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₅H₂₁N·ClH

InChI: InChI=1S/C15H21N.ClH/c1-11-7-12(2)9-13(8-11)15(5-6-15)10-16-14-3-4-14;/h7-9,14,16H,3-6,10H2,1-2H3;1H

InChI key: InChIKey=CUDFQLNTNVYNRT-UHFFFAOYSA-N

SMILES: C(NC1CC1)C2(CC2)C3=CC(C)=CC(C)=C3.Cl

Synonyms:

• Cyclopropanemethanamine, N-cyclopropyl-1-(3,5-dimethylphenyl)-, hydrochloride (1:1)