CAS 1354949-62-4

1-Pyrrolidineacetic acid, α-(4-bromo-2-thienyl)-, hydrochloride (1:1)

Description:

1-Pyrrolidineacetic acid, α-(4-bromo-2-thienyl)-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a thienyl group substituted with a bromine atom. This compound typically exists as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in medicinal chemistry and pharmacology. The presence of the thienyl moiety may contribute to its biological activity, potentially influencing interactions with biological targets. The compound's molecular structure suggests it may exhibit properties such as being a potential ligand or inhibitor in biochemical pathways. Additionally, the hydrochloride form indicates that it can be used in formulations requiring stability and ease of handling. As with many compounds containing heterocycles, it may also display interesting pharmacokinetic properties, including absorption, distribution, metabolism, and excretion characteristics. Overall, this compound's specific characteristics and potential applications would require further investigation through experimental studies and analyses.

Formula: C₁₀H₁₂BrNO₂S·ClH

InChI: InChI=1S/C10H12BrNO2S.ClH/c11-7-5-8(15-6-7)9(10(13)14)12-3-1-2-4-12;/h5-6,9H,1-4H2,(H,13,14);1H

InChI key: InChIKey=BCKBOQRYCJAEPZ-UHFFFAOYSA-N

SMILES: C(C(O)=O)(C1=CC(Br)=CS1)N2CCCC2.Cl

Synonyms:

• 1-Pyrrolidineacetic acid, α-(4-bromo-2-thienyl)-, hydrochloride (1:1)
• 2-(4-Bromothiophen-2-yl)-2-(pyrrolidin-1-yl)acetic acid hydrochloride

2-(4-Bromothiophen-2-yl)-2-(pyrrolidin-1-yl)acetic acid hydrochloride

CAS: 1354949-62-4

Versatile small molecule scaffold

Formula: C₁₀H₁₃BrClNO₂S

Purity: Min. 95%

Molecular weight: 326.64 g/mol

Ref: 3D-EEC94962