CAS 1354949-68-0

5H-1,2,4-Triazolo[4,3-a]azepine-3-propanamine, 6,7,8,9-tetrahydro-, hydrochloride (1:1)

Description:

5H-1,2,4-Triazolo[4,3-a]azepine-3-propanamine, 6,7,8,9-tetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its complex bicyclic structure, which includes a triazole and an azepine moiety. This compound typically exhibits properties associated with both heterocyclic compounds and amines, such as potential biological activity and solubility in polar solvents due to the presence of the hydrochloride salt form. The tetrahydro configuration suggests that it is a saturated derivative, which may influence its reactivity and stability. The presence of the amine group indicates potential for hydrogen bonding and interaction with biological targets, making it of interest in medicinal chemistry. Its CAS number, 1354949-68-0, allows for precise identification in chemical databases. Overall, this compound may have applications in pharmaceuticals, particularly in the development of drugs targeting neurological or psychiatric conditions, although specific biological activities would require further investigation through empirical studies.

Formula: C₁₀H₁₈N₄·ClH

InChI: InChI=1S/C10H18N4.ClH/c11-7-4-6-10-13-12-9-5-2-1-3-8-14(9)10;/h1-8,11H2;1H

InChI key: InChIKey=LKAMQLMMUSMBCO-UHFFFAOYSA-N

SMILES: C(CCN)C=1N2C(=NN1)CCCCC2.Cl

Synonyms:

• 5H-1,2,4-Triazolo[4,3-a]azepine-3-propanamine, 6,7,8,9-tetrahydro-, hydrochloride (1:1)
• 3-(6,7,8,9-Tetrahydro-5H-[1,2,4]triazolo[4,5-a]azepin-3-yl)propan-1-amine hydrochloride

3-{5H,6H,7H,8H,9H-[1,2,4]Triazolo[4,3-a]azepin-3-yl}propan-1-amine hydrochloride

CAS: 1354949-68-0

Versatile small molecule scaffold

Formula: C₁₀H₁₉ClN₄

Purity: Min. 95%

Molecular weight: 230.74 g/mol

Ref: 3D-EEC94968