CAS 1354949-83-9

Benzoic acid, 2-amino-3-fluoro-6-methoxy-

Description:

Benzoic acid, 2-amino-3-fluoro-6-methoxy- is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety with specific substituents. The presence of an amino group (-NH2) indicates potential basicity and reactivity, while the fluoro group (-F) introduces electronegativity, influencing the compound's polarity and reactivity. The methoxy group (-OCH3) contributes to the compound's overall hydrophobic character and can affect its solubility in various solvents. This compound may exhibit interesting biological activities due to its functional groups, making it of interest in pharmaceutical and chemical research. Its molecular structure suggests potential applications in drug development, agrochemicals, or as a building block in organic synthesis. Additionally, the presence of multiple functional groups can lead to diverse chemical reactivity, including nucleophilic substitutions and electrophilic aromatic substitutions. Understanding its properties, such as melting point, boiling point, and solubility, would require experimental data, which can vary based on environmental conditions and the presence of other substances.

Formula: C₈H₈FNO₃

InChI: InChI=1S/C8H8FNO3/c1-13-5-3-2-4(9)7(10)6(5)8(11)12/h2-3H,10H2,1H3,(H,11,12)

InChI key: InChIKey=VUQCDRYOWXVSPB-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(OC)C=CC(F)=C1N

Synonyms:

• 2-Amino-3-fluoro-6-methoxybenzoic acid
• Benzoic acid, 2-amino-3-fluoro-6-methoxy-

2-Amino-3-fluoro-6-methoxybenzoic acid

CAS: 1354949-83-9

Versatile small molecule scaffold

Formula: C₈H₈FNO₃

Purity: Min. 95%

Molecular weight: 185.15 g/mol

Ref: 3D-EEC94983