CAS 1354949-84-0

2-[(4-Fluorophenyl)thio]ethanesulfonyl chloride

Description:

2-[(4-Fluorophenyl)thio]ethanesulfonyl chloride is an organic compound characterized by the presence of a sulfonyl chloride functional group, which is known for its reactivity and ability to act as a sulfonating agent. The compound features a thioether linkage, connecting a 4-fluorophenyl group to an ethanesulfonyl moiety. This structure imparts unique chemical properties, including the potential for nucleophilic substitution reactions due to the electrophilic nature of the sulfonyl chloride. The presence of the fluorine atom on the phenyl ring can influence the compound's reactivity and polarity, potentially enhancing its solubility in organic solvents. Additionally, the sulfonyl chloride group is highly reactive towards amines, alcohols, and other nucleophiles, making this compound useful in synthetic organic chemistry for the preparation of sulfonamides and other derivatives. Safety precautions should be observed when handling this compound, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or moisture.

Formula: C₈H₈ClFO₂S₂

InChI: InChI=1S/C8H8ClFO2S2/c9-14(11,12)6-5-13-8-3-1-7(10)2-4-8/h1-4H,5-6H2

InChI key: InChIKey=LUVFILQFCMRRCV-UHFFFAOYSA-N

SMILES: S(CCS(Cl)(=O)=O)C1=CC=C(F)C=C1

Synonyms:

• 2-[(4-Fluorophenyl)thio]ethanesulfonyl chloride
• Ethanesulfonyl chloride, 2-[(4-fluorophenyl)thio]-