CAS 1354949-91-9

5-(5,6-Dimethyl-1H-benzimidazol-2-yl)quinoline

Description:

5-(5,6-Dimethyl-1H-benzimidazol-2-yl)quinoline is an organic compound characterized by its complex structure, which includes a quinoline moiety fused with a benzimidazole ring. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and fluorescence. The presence of the dimethyl groups on the benzimidazole ring can influence its solubility and reactivity, making it of interest in medicinal chemistry and material science. The compound may also display interesting electronic properties due to the conjugated system formed by the quinoline and benzimidazole rings, which can affect its absorption and emission spectra. Additionally, it may have applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Its synthesis and characterization would involve standard organic chemistry techniques, and its stability and reactivity would be influenced by the functional groups present in its structure. Overall, this compound represents a class of molecules that are valuable in both research and industrial applications.

Formula: C₁₈H₁₅N₃

InChI: InChI=1S/C18H15N3/c1-11-9-16-17(10-12(11)2)21-18(20-16)14-5-3-7-15-13(14)6-4-8-19-15/h3-10H,1-2H3,(H,20,21)

InChI key: InChIKey=RXORHJVRXLWQMS-UHFFFAOYSA-N

SMILES: CC=1C=C2NC(=NC2=CC1C)C=3C4=C(C=CC3)N=CC=C4

Synonyms:

• Quinoline, 5-(5,6-dimethyl-1H-benzimidazol-2-yl)-
• 5-(5,6-Dimethyl-1H-benzimidazol-2-yl)quinoline