CAS 1354949-93-1

3,4-Dimethoxy-5-[(methylsulfonyl)amino]benzoic acid

Description:

3,4-Dimethoxy-5-[(methylsulfonyl)amino]benzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with two methoxy groups and a methylsulfonylamino group. The presence of the methoxy groups enhances its solubility in organic solvents and may influence its biological activity. The methylsulfonylamino group introduces a sulfonyl functional group, which can enhance the compound's reactivity and potential interactions with biological targets. This compound is likely to exhibit moderate polarity due to the combination of hydrophobic aromatic and hydrophilic functional groups. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Additionally, the compound's properties may include stability under standard conditions, but it could be sensitive to extreme pH or temperature variations. Overall, 3,4-Dimethoxy-5-[(methylsulfonyl)amino]benzoic acid represents a versatile chemical entity with potential utility in medicinal chemistry and related fields.

Formula: C₁₀H₁₃NO₆S

InChI: InChI=1S/C10H13NO6S/c1-16-8-5-6(10(12)13)4-7(9(8)17-2)11-18(3,14)15/h4-5,11H,1-3H3,(H,12,13)

InChI key: InChIKey=KYWRGYORRNKLFJ-UHFFFAOYSA-N

SMILES: N(S(C)(=O)=O)C1=C(OC)C(OC)=CC(C(O)=O)=C1

Synonyms:

• 3,4-Dimethoxy-5-[(methylsulfonyl)amino]benzoic acid
• Benzoic acid, 3,4-dimethoxy-5-[(methylsulfonyl)amino]-

3-Methanesulfonamido-4,5-dimethoxybenzoic acid

CAS: 1354949-93-1

Versatile small molecule scaffold

Formula: C₁₀H₁₃NO₆S

Purity: Min. 95%

Molecular weight: 275.28 g/mol

Ref: 3D-EEC94993