CAS 1354949-96-4

1-(Chloromethyl)-4-[(difluoromethyl)sulfonyl]benzene

Description:

1-(Chloromethyl)-4-[(difluoromethyl)sulfonyl]benzene, with the CAS number 1354949-96-4, is an organic compound characterized by its aromatic structure, which includes a chloromethyl group and a difluoromethylsulfonyl substituent. This compound features a benzene ring that is substituted at the para position with a chloromethyl group, enhancing its reactivity and potential for further chemical transformations. The difluoromethylsulfonyl group introduces both fluorine atoms, which can significantly influence the compound's electronic properties and lipophilicity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The presence of the sulfonyl group contributes to its potential as a sulfonamide derivative, which may exhibit biological activity. Additionally, the compound's unique functional groups suggest it may participate in nucleophilic substitution reactions, making it a valuable intermediate in synthetic organic chemistry. Safety and handling precautions should be observed due to the presence of chlorine and fluorine, which can pose health and environmental risks.

Formula: C₈H₇ClF₂O₂S

InChI: InChI=1S/C8H7ClF2O2S/c9-5-6-1-3-7(4-2-6)14(12,13)8(10)11/h1-4,8H,5H2

InChI key: InChIKey=RYKZUMZCNPGQAC-UHFFFAOYSA-N

SMILES: S(C(F)F)(=O)(=O)C1=CC=C(CCl)C=C1

Synonyms:

• 1-(Chloromethyl)-4-[(difluoromethyl)sulfonyl]benzene
• 1-(Chloromethyl)-4-difluoromethanesulfonylbenzene
• Benzene, 1-(chloromethyl)-4-[(difluoromethyl)sulfonyl]-

1-(Chloromethyl)-4-difluoromethanesulfonylbenzene

CAS: 1354949-96-4

Versatile small molecule scaffold

Formula: C₈H₇ClF₂O₂S

Purity: Min. 95%

Molecular weight: 240.66 g/mol

Ref: 3D-EEC94996