CAS 1354949-98-6

Butanamide, 3-methyl-2-[(2,2,2-trifluoroethyl)amino]-, hydrochloride (1:1)

Description:

Butanamide, 3-methyl-2-[(2,2,2-trifluoroethyl)amino]-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is indicative of its potential as a polar molecule with hydrogen bonding capabilities. The presence of a trifluoroethyl group contributes to its lipophilicity and may influence its biological activity, particularly in pharmacological contexts. The hydrochloride form suggests that it is a salt, enhancing its solubility in water and making it suitable for various applications, including medicinal chemistry. The compound's structure includes a butanamide backbone with a methyl group and a trifluoroethyl amino substituent, which may impart unique properties such as increased stability or altered reactivity compared to simpler amides. Its specific interactions with biological targets can be influenced by the trifluoromethyl group, which is known to enhance metabolic stability and modulate pharmacokinetic properties. Overall, this compound's characteristics make it of interest in research and development, particularly in the fields of pharmaceuticals and agrochemicals.

Formula: C₇H₁₃F₃N₂O·ClH

InChI: InChI=1S/C7H13F3N2O.ClH/c1-4(2)5(6(11)13)12-3-7(8,9)10;/h4-5,12H,3H2,1-2H3,(H2,11,13);1H

InChI key: InChIKey=LOCFAQMARXRUGQ-UHFFFAOYSA-N

SMILES: C(NCC(F)(F)F)(C(C)C)C(N)=O.Cl

Synonyms:

• Butanamide, 3-methyl-2-[(2,2,2-trifluoroethyl)amino]-, hydrochloride (1:1)

3-Methyl-2-[(2,2,2-trifluoroethyl)amino]butanamide hydrochloride

CAS: 1354949-98-6

Versatile small molecule scaffold

Formula: C₇H₁₄ClF₃N₂O

Purity: Min. 95%

Molecular weight: 234.65 g/mol

Ref: 3D-EEC94998