CAS 1354949-99-7

Pyrido[4,3-c]pyridazin-3-amine, N-ethyl-5,6,7,8-tetrahydro-, hydrobromide (1:2)

Description:

Pyrido[4,3-c]pyridazin-3-amine, N-ethyl-5,6,7,8-tetrahydro-, hydrobromide (1:2) is a chemical compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyridazine rings. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, which contributes to its unique chemical properties. The hydrobromide salt form suggests that it is a protonated species, enhancing its solubility in polar solvents and potentially influencing its biological activity. The N-ethyl substitution indicates the presence of an ethyl group attached to the nitrogen atom, which can affect the compound's lipophilicity and interaction with biological targets. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its specific applications and biological activities would depend on further research and characterization. As with many nitrogen-containing heterocycles, it may participate in various chemical reactions, including nucleophilic substitutions and cyclization processes, making it a versatile building block in organic synthesis.

Formula: C₉H₁₄N₄·2BrH

InChI: InChI=1S/C9H14N4.2BrH/c1-2-11-9-5-7-6-10-4-3-8(7)12-13-9;;/h5,10H,2-4,6H2,1H3,(H,11,13);2*1H

InChI key: InChIKey=RIHIBQHKIZBJTP-UHFFFAOYSA-N

SMILES: N(CC)C=1C=C2C(=NN1)CCNC2.Br

Synonyms:

• Pyrido[4,3-c]pyridazin-3-amine, N-ethyl-5,6,7,8-tetrahydro-, hydrobromide (1:2)