CAS 1354950-12-1

Benzenamine, 4-fluoro-2-(2-propyn-1-yloxy)-, hydrochloride (1:1)

Description:

Benzenamine, 4-fluoro-2-(2-propyn-1-yloxy)-, hydrochloride (1:1) is a chemical compound characterized by its aromatic amine structure, which includes a fluorine substituent and a propynyl ether group. The presence of the fluorine atom typically enhances the compound's reactivity and can influence its biological activity. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. The compound's structure suggests potential uses in medicinal chemistry, particularly in the development of new therapeutic agents. Its unique functional groups may contribute to specific interactions with biological targets, making it of interest in drug discovery. Additionally, the presence of the propynyl group may impart unique properties, such as increased lipophilicity or the ability to participate in further chemical reactions. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.

Formula: C₉H₈FNO·ClH

InChI: InChI=1S/C9H8FNO.ClH/c1-2-5-12-9-6-7(10)3-4-8(9)11;/h1,3-4,6H,5,11H2;1H

InChI key: InChIKey=FZKVYBFPAHBKGE-UHFFFAOYSA-N

SMILES: O(CC#C)C1=C(N)C=CC(F)=C1.Cl

Synonyms:

• Benzenamine, 4-fluoro-2-(2-propyn-1-yloxy)-, hydrochloride (1:1)

4-Fluoro-2-(prop-2-yn-1-yloxy)aniline hydrochloride

CAS: 1354950-12-1

Versatile small molecule scaffold

Formula: C₉H₉ClFNO

Purity: Min. 95%

Molecular weight: 201.62 g/mol

Ref: 3D-EEC95012