
CAS 1354950-18-7
:Cyclopropanamine, 2-(2,6-dichlorophenyl)-, hydrochloride (1:1)
Description:
Cyclopropanamine, 2-(2,6-dichlorophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its cyclopropane structure and the presence of a dichlorophenyl group. The compound features a cyclopropanamine moiety, which contributes to its unique reactivity and potential biological activity. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The presence of the 2,6-dichlorophenyl group suggests potential interactions with biological targets, possibly influencing its pharmacological properties. This compound may exhibit properties typical of amines, such as basicity, and could participate in hydrogen bonding due to the amine functional group. Its specific applications and effects would depend on further research, particularly in the fields of medicinal chemistry and drug development. As with any chemical substance, safety and handling precautions should be observed, especially considering the presence of chlorine substituents, which can affect toxicity and environmental impact.
Formula:C9H9Cl2N·ClH
InChI:InChI=1S/C9H9Cl2N.ClH/c10-6-2-1-3-7(11)9(6)5-4-8(5)12;/h1-3,5,8H,4,12H2;1H
InChI key:InChIKey=TVLVGKZGOXGIFO-UHFFFAOYSA-N
SMILES:ClC1=C(C(Cl)=CC=C1)C2C(N)C2.Cl
Synonyms:- Cyclopropanamine, 2-(2,6-dichlorophenyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.