CymitQuimica logo

CAS 1354950-22-3

:

4(3H)-Pyrimidinone, 2-(1-amino-1-methylpropyl)-6-(methoxymethyl)-, hydrochloride (1:1)

Description:
4(3H)-Pyrimidinone, 2-(1-amino-1-methylpropyl)-6-(methoxymethyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrimidinone core structure, which features a six-membered aromatic ring containing nitrogen atoms. This compound includes an amino group and a methoxymethyl substituent, contributing to its potential biological activity. The hydrochloride form indicates that it is a salt, enhancing its solubility in water, which is often beneficial for pharmacological applications. The presence of the amino group suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure allows for various functional group interactions, which may influence its reactivity and stability. As with many pyrimidine derivatives, it may exhibit properties such as antimicrobial or antiviral activity, although specific biological effects would depend on further empirical studies. Overall, this compound's unique structural features position it as a candidate for further research in drug development and therapeutic applications.
Formula:C10H17N3O2·ClH
InChI:InChI=1S/C10H17N3O2.ClH/c1-4-10(2,11)9-12-7(6-15-3)5-8(14)13-9;/h5H,4,6,11H2,1-3H3,(H,12,13,14);1H
InChI key:InChIKey=NMJCMUAKCLVNOP-UHFFFAOYSA-N
SMILES:C(CC)(C)(N)C=1NC(COC)=CC(=O)N1.Cl
Synonyms:
  • 4(3H)-Pyrimidinone, 2-(1-amino-1-methylpropyl)-6-(methoxymethyl)-, hydrochloride (1:1)
Found 1 products.