CymitQuimica logo

CAS 1354950-44-9

:

2-[1-(Aminomethyl)-2,2,2-trifluoroethoxy]acetic acid

Description:
2-[1-(Aminomethyl)-2,2,2-trifluoroethoxy]acetic acid is a chemical compound characterized by its unique structure, which includes a trifluoroethoxy group and an amino group. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical applications. The amino group can participate in hydrogen bonding, which may affect its solubility and reactivity. Additionally, the compound's trifluoromethyl group can impart unique electronic properties, potentially affecting its interaction with biological targets. Its molecular structure suggests potential uses in medicinal chemistry, particularly in the development of drugs that require specific interactions with biological systems. Overall, 2-[1-(Aminomethyl)-2,2,2-trifluoroethoxy]acetic acid is notable for its combination of functional groups, which may confer distinctive chemical and biological properties.
Formula:C5H8F3NO3
InChI:InChI=1S/C5H8F3NO3/c6-5(7,8)3(1-9)12-2-4(10)11/h3H,1-2,9H2,(H,10,11)
InChI key:InChIKey=CORHSPNAMKSFPB-UHFFFAOYSA-N
SMILES:C(OCC(O)=O)(C(F)(F)F)CN
Synonyms:
  • Acetic acid, 2-[1-(aminomethyl)-2,2,2-trifluoroethoxy]-
  • 2-[1-(Aminomethyl)-2,2,2-trifluoroethoxy]acetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.