CAS 1354950-57-4

3-Piperidinamine, 1-(4-pyrimidinyl)-, hydrochloride (1:2)

Description:

3-Piperidinamine, 1-(4-pyrimidinyl)-, hydrochloride (1:2) is a chemical compound characterized by its piperidine and pyrimidine moieties, which contribute to its potential biological activity. The presence of the piperidinamine structure suggests that it may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds. The hydrochloride form indicates that the compound is a salt, which often enhances its solubility in water and may influence its pharmacokinetic properties. This compound is likely to be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Its specific interactions and mechanisms of action would depend on the functional groups present and their spatial arrangement, which can affect binding affinity to biological targets. As with many compounds containing nitrogen heterocycles, it may also exhibit diverse reactivity and stability under different conditions. Further studies would be necessary to elucidate its full range of characteristics and potential applications in research or therapeutic contexts.

Formula: C₉H₁₄N₄·2ClH

InChI: InChI=1S/C9H14N4.2ClH/c10-8-2-1-5-13(6-8)9-3-4-11-7-12-9;;/h3-4,7-8H,1-2,5-6,10H2;2*1H

InChI key: InChIKey=WGNCAYCUVBGFTP-UHFFFAOYSA-N

SMILES: NC1CN(CCC1)C=2C=CN=CN2.Cl

Synonyms:

• 3-Piperidinamine, 1-(4-pyrimidinyl)-, hydrochloride (1:2)

1-(Pyrimidin-4-yl)piperidin-3-amine dihydrochloride

CAS: 1354950-57-4

Versatile small molecule scaffold

Formula: C₉H₁₆Cl₂N₄

Purity: Min. 95%

Molecular weight: 251.15 g/mol

Ref: 3D-EEC95057