CAS 1354950-73-4

2-Piperidinone, 3-amino-1-(1,3-dimethyl-1H-pyrazol-5-yl)-

Description:

2-Piperidinone, 3-amino-1-(1,3-dimethyl-1H-pyrazol-5-yl)-, identified by its CAS number 1354950-73-4, is a chemical compound characterized by its piperidinone core structure, which features a six-membered ring containing a nitrogen atom. This compound includes an amino group and a 1,3-dimethyl-1H-pyrazole moiety, contributing to its potential biological activity. The presence of the piperidinone and pyrazole functionalities suggests that it may exhibit interesting pharmacological properties, possibly acting as a ligand for various biological targets. Its molecular structure indicates that it may be soluble in polar solvents, and its reactivity could be influenced by the functional groups present. The compound's specific characteristics, such as melting point, boiling point, and spectral data, would typically be determined through experimental methods. Overall, 2-Piperidinone, 3-amino-1-(1,3-dimethyl-1H-pyrazol-5-yl)- represents a class of compounds that may have applications in medicinal chemistry and drug development.

Formula: C₁₀H₁₆N₄O

InChI: InChI=1S/C10H16N4O/c1-7-6-9(13(2)12-7)14-5-3-4-8(11)10(14)15/h6,8H,3-5,11H2,1-2H3

InChI key: InChIKey=HRUGBDOZVXLAIU-UHFFFAOYSA-N

SMILES: CN1C(=CC(C)=N1)N2C(=O)C(N)CCC2

Synonyms:

• 3-Amino-1-(2,5-dimethyl-2H-pyrazol-3-yl)-piperidin-2-one
• 3-Amino-1-(1,3-dimethyl-1H-pyrazol-5-yl)piperidin-2-one
• 2-Piperidinone, 3-amino-1-(1,3-dimethyl-1H-pyrazol-5-yl)-
• 3-Amino-1-(2,5-dimethylpyrazol-3-yl)piperidin-2-one

3-Amino-1-(1,3-dimethyl-1H-pyrazol-5-yl)piperidin-2-one

CAS: 1354950-73-4

Versatile small molecule scaffold

Formula: C₁₀H₁₆N₄O

Purity: Min. 95%

Molecular weight: 208.26 g/mol

Ref: 3D-EEC95073