CAS 1354950-74-5

4(3H)-Pyrimidinone, 2-(1-aminocyclohexyl)-, hydrochloride (1:1)

Description:

4(3H)-Pyrimidinone, 2-(1-aminocyclohexyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrimidinone core structure, which features a six-membered aromatic ring containing nitrogen atoms. This compound is typically encountered as a hydrochloride salt, indicating that it is soluble in water and may exhibit different properties compared to its free base form. The presence of the 1-aminocyclohexyl group suggests that it may possess biological activity, potentially interacting with various receptors or enzymes in biological systems. The hydrochloride form often enhances the stability and solubility of the compound, making it suitable for pharmaceutical applications. In terms of physical properties, it may exhibit characteristics typical of amines and heterocycles, such as basicity and potential for hydrogen bonding. Its specific applications and effects would depend on further studies, particularly in the context of medicinal chemistry or pharmacology, where such compounds are often explored for therapeutic potential.

Formula: C₁₀H₁₅N₃O·ClH

InChI: InChI=1S/C10H15N3O.ClH/c11-10(5-2-1-3-6-10)9-12-7-4-8(14)13-9;/h4,7H,1-3,5-6,11H2,(H,12,13,14);1H

InChI key: InChIKey=JLJJBEZPDMQDGR-UHFFFAOYSA-N

SMILES: NC1(C=2NC(=O)C=CN2)CCCCC1.Cl

Synonyms:

• 4(3H)-Pyrimidinone, 2-(1-aminocyclohexyl)-, hydrochloride (1:1)

2-(1-Aminocyclohexyl)-1,4-dihydropyrimidin-4-one hydrochloride

Controlled Product

CAS: 1354950-74-5

Please enquire for more information about 2-(1-Aminocyclohexyl)-1,4-dihydropyrimidin-4-one hydrochloride including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₀H₁₆ClN₃O

Purity: Min. 95%

Molecular weight: 229.71 g/mol

Ref: 3D-EEC95074