CAS 1354950-84-7

4-Piperidinecarboxamide, N-(3,4-dichlorophenyl)-, hydrochloride (1:1)

Description:

4-Piperidinecarboxamide, N-(3,4-dichlorophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of the N-(3,4-dichlorophenyl) moiety indicates that the compound has a dichlorophenyl group attached to the nitrogen atom of the piperidine, contributing to its biological activity and potential pharmacological properties. As a hydrochloride salt, it is typically more soluble in water than its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The compound may exhibit properties such as analgesic or anti-inflammatory effects, depending on its interaction with biological targets. Its molecular structure suggests potential interactions with neurotransmitter systems, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, particularly those with potential biological activity.

Formula: C₁₂H₁₄Cl₂N₂O·ClH

InChI: InChI=1S/C12H14Cl2N2O.ClH/c13-10-2-1-9(7-11(10)14)16-12(17)8-3-5-15-6-4-8;/h1-2,7-8,15H,3-6H2,(H,16,17);1H

InChI key: InChIKey=SSBAHOFHCXCSBB-UHFFFAOYSA-N

SMILES: N(C(=O)C1CCNCC1)C2=CC(Cl)=C(Cl)C=C2.Cl

Synonyms:

• 4-Piperidinecarboxamide, N-(3,4-dichlorophenyl)-, hydrochloride (1:1)