
CAS 1354950-98-3
:Description:
The chemical substance with the CAS number 1354950-98-3 is known as 2,4-Dichloro-5-(trifluoromethyl)pyrimidine. This compound is characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of two chlorine atoms and a trifluoromethyl group at specific positions on the ring contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. It is often utilized in agricultural chemistry, particularly as a herbicide or in the development of agrochemicals, due to its ability to inhibit certain biochemical pathways in plants. The compound's stability and reactivity can be influenced by the electronegative trifluoromethyl group, which can affect its interactions with other molecules. Safety and handling precautions are essential when working with this substance, as it may pose environmental and health risks. Overall, 2,4-Dichloro-5-(trifluoromethyl)pyrimidine is a significant compound in the field of chemistry, particularly in applications related to agriculture and biochemistry.
Formula:C13H21N3O·ClH
InChI:InChI=1S/C13H21N3O.ClH/c1-3-13(2,14)12-15-10-8-6-4-5-7-9(10)11(17)16-12;/h3-8,14H2,1-2H3,(H,15,16,17);1H
InChI key:InChIKey=BKBKDOCXKMNLQQ-UHFFFAOYSA-N
SMILES:O=C1C2=C(NC(C(CC)(C)N)=N1)CCCCC2.Cl
Synonyms:- 2-(2-Aminobutan-2-yl)-3H,4H,5H,6H,7H,8H,9H-cyclohepta[d]pyrimidin-4-one hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.