CAS 1354951-01-1

3-Amino-1-(1-methyl-1H-pyrazol-3-yl)-2-piperidinone

Description:

3-Amino-1-(1-methyl-1H-pyrazol-3-yl)-2-piperidinone is a chemical compound characterized by its unique structural features, which include a piperidinone ring and a pyrazole moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of amino and carbonyl functional groups. The amino group can participate in hydrogen bonding, enhancing its reactivity and potential interactions with biological targets. The presence of the pyrazole ring may contribute to its pharmacological properties, as pyrazoles are often found in various bioactive compounds. Additionally, the compound's molecular structure suggests it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific reactivity and biological activity would depend on the context of its use, including the presence of other functional groups and the overall molecular environment. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₉H₁₄N₄O

InChI: InChI=1S/C9H14N4O/c1-12-6-4-8(11-12)13-5-2-3-7(10)9(13)14/h4,6-7H,2-3,5,10H2,1H3

InChI key: InChIKey=GXVJMKKKYNEMNA-UHFFFAOYSA-N

SMILES: O=C1N(CCCC1N)C2=NN(C)C=C2

Synonyms:

• 3-Amino-1-(1-methyl-1H-pyrazol-3-yl)-2-piperidinone
• 2-Piperidinone, 3-amino-1-(1-methyl-1H-pyrazol-3-yl)-

3-Amino-1-(1-methyl-1H-pyrazol-3-yl)piperidin-2-one

CAS: 1354951-01-1

Versatile small molecule scaffold

Formula: C₉H₁₄N₄O

Purity: Min. 95%

Molecular weight: 194.23 g/mol

Ref: 3D-EEC95101