CAS 1354951-03-3

3-Ethoxyspiro[3.5]nonan-1-ol

Description:

3-Ethoxyspiro[3.5]nonan-1-ol is a chemical compound characterized by its unique spirocyclic structure, which features a nonane backbone with an ethoxy group and a hydroxyl functional group. The spiro configuration indicates that the compound contains two rings that share a single atom, contributing to its distinctive three-dimensional shape. This compound is likely to exhibit properties typical of alcohols, such as the ability to form hydrogen bonds, which can influence its solubility in polar solvents and its boiling point. The presence of the ethoxy group may also impart some degree of hydrophobic character, affecting its reactivity and interactions with other molecules. Additionally, the compound may have applications in organic synthesis or as an intermediate in the production of more complex chemical entities. Its specific reactivity and stability would depend on the surrounding conditions, such as temperature and pH, as well as the presence of other functional groups in a given reaction environment.

Formula: C₁₁H₂₀O₂

InChI: InChI=1S/C11H20O2/c1-2-13-10-8-9(12)11(10)6-4-3-5-7-11/h9-10,12H,2-8H2,1H3

InChI key: InChIKey=XNSLECDIDNVTEC-UHFFFAOYSA-N

SMILES: O(CC)C1C2(C(O)C1)CCCCC2

Synonyms:

• Spiro[3.5]nonan-1-ol, 3-ethoxy-
• 3-Ethoxyspiro[3.5]nonan-1-ol

3-Ethoxyspiro[3.5]nonan-1-ol

CAS: 1354951-03-3

Versatile small molecule scaffold

Formula: C₁₁H₂₀O₂

Purity: Min. 95%

Molecular weight: 184.27 g/mol

Ref: 3D-EEC95103