CAS 1354951-09-9

5,7-Dimethylimidazo[1,2-a]pyrimidine-3-carboxaldehyde

Description:

5,7-Dimethylimidazo[1,2-a]pyrimidine-3-carboxaldehyde is a heterocyclic organic compound characterized by its fused imidazole and pyrimidine rings, which contribute to its unique chemical properties. This compound features two methyl groups at the 5 and 7 positions of the imidazo ring, enhancing its lipophilicity and potentially influencing its biological activity. The presence of a carboxaldehyde functional group at the 3-position introduces reactivity, allowing for further chemical modifications or interactions in various synthetic pathways. It is important to note that compounds of this type may exhibit biological activities, including potential mutagenicity or carcinogenicity, often studied in the context of food chemistry and toxicology. The compound's molecular structure suggests it may participate in various chemical reactions, such as nucleophilic additions or condensation reactions, making it of interest in medicinal chemistry and organic synthesis. As with many heterocycles, its solubility and stability can vary depending on the solvent and environmental conditions, which are crucial for its application in research and industry.

Formula: C₉H₉N₃O

InChI: InChI=1S/C9H9N3O/c1-6-3-7(2)12-8(5-13)4-10-9(12)11-6/h3-5H,1-2H3

InChI key: InChIKey=HWIPHTCMCUIBOM-UHFFFAOYSA-N

SMILES: C(=O)C=1N2C(=NC1)N=C(C)C=C2C

Synonyms:

• Imidazo[1,2-a]pyrimidine-3-carboxaldehyde, 5,7-dimethyl-
• 5,7-Dimethylimidazo[1,2-a]pyrimidine-3-carboxaldehyde

5,7-Dimethylimidazo[1,2-a]pyrimidine-3-carbaldehyde

CAS: 1354951-09-9

Versatile small molecule scaffold

Formula: C₉H₉N₃O

Purity: Min. 95%

Molecular weight: 175.19 g/mol

Ref: 3D-EEC95109